| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | Cc1ccccc1C[C@@H]2C(=O)N(/C(=C(\C#N)/C(=O)N[C@@H](C)c3ccccc3)/S2)c4ccc(c(c4)C)C |
| Molar mass | 495.19805 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 11.27767 |
| Number of basis functions | 602 |
| Zero Point Vibrational Energy | 0.564172 |
| InChI | InChI=1/C30H29N3O2S/c1-19-14-15-25(16-21(19)3)33-29(35)27(17-24-13-9-8-10-20(24)2)36-30(33)26(18-31)28(34)32-22(4)23-11-6-5-7-12-23/h5-16,22,27H,17H2,1-4H3,(H,32,34)/b30-26-/t22-,27+/m0/s1/f/h32H |
| Number of occupied orbitals | 131 |
| Energy at 0K | -1863.000001 |
| Input SMILES | N#C/C(=C\1/S[C@@H](C(=O)N1c1ccc(c(c1)C)C)Cc1ccccc1C)/C(=O)N[C@H](c1ccccc1)C |
| Number of orbitals | 602 |
| Number of virtual orbitals | 471 |
| Standard InChI | InChI=1S/C30H29N3O2S/c1-19-14-15-25(16-21(19)3)33-29(35)27(17-24-13-9-8-10-20(24)2)36-30(33)26(18-31)28(34)32-22(4)23-11-6-5-7-12-23/h5-16,22,27H,17H2,1-4H3,(H,32,34)/b30-26-/t22-,27+/m0/s1 |
| Total Energy | -1862.967873 |
| Entropy | 3.434915D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1862.966929 |
| Standard InChI Key | InChIKey=PXGVKFLNQPZBBW-DDENKWCMSA-N |
| Final Isomeric SMILES | C[C@H](NC(=O)C(/C#N)=C1\S[C@H](Cc2ccccc2C)C(=O)N1c3ccc(C)c(C)c3)c4ccccc4 |
| SMILES | N#C/C(=C\1/S[C@@H](C(=O)N1c1ccc(c(c1)C)C)Cc1ccccc1C)/C(=O)N[C@H](c1ccccc1)C |
| Gibbs energy | -1863.069341 |
| Thermal correction to Energy | 0.596299 |
| Thermal correction to Enthalpy | 0.597244 |
| Thermal correction to Gibbs energy | 0.494832 |