| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | Cc1ccccc1NC(=O)[C@@H]2[C@H]3C=C[C@@]4([C@@H]2C(=O)N([C@@H]4C(=O)NC(C)(C)C)CC(C)C)O3 |
| Molar mass | 439.24711 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 12.02407 |
| Number of basis functions | 546 |
| Zero Point Vibrational Energy | 0.594135 |
| InChI | InChI=1/C25H33N3O4/c1-14(2)13-28-20(22(30)27-24(4,5)6)25-12-11-17(32-25)18(19(25)23(28)31)21(29)26-16-10-8-7-9-15(16)3/h7-12,14,17-20H,13H2,1-6H3,(H,26,29)(H,27,30)/t17-,18-,19+,20-,25+/m1/s1/f/h26-27H |
| Number of occupied orbitals | 118 |
| Energy at 0K | -1428.154417 |
| Input SMILES | CC(CN1C(=O)[C@H]2[C@]3([C@H]1C(=O)NC(C)(C)C)C=C[C@H]([C@H]2C(=O)Nc1ccccc1C)O3)C |
| Number of orbitals | 546 |
| Number of virtual orbitals | 428 |
| Standard InChI | InChI=1S/C25H33N3O4/c1-14(2)13-28-20(22(30)27-24(4,5)6)25-12-11-17(32-25)18(19(25)23(28)31)21(29)26-16-10-8-7-9-15(16)3/h7-12,14,17-20H,13H2,1-6H3,(H,26,29)(H,27,30)/t17-,18-,19+,20-,25+/m1/s1 |
| Total Energy | -1428.125039 |
| Entropy | 3.145799D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1428.124095 |
| Standard InChI Key | InChIKey=SMHKVONVNIZTLM-GEZZUNRVSA-N |
| Final Isomeric SMILES | C[C]1[CH][CH][CH][CH][C]1NC(=O)[C@@H]2[C@@H]3O[C@@]4(C=C3)[C@@H]2C(=O)N(CC(C)C)[C@@H]4C(=O)NC(C)(C)C |
| SMILES | CC(CN1C(=O)[C@H]2[C@]3([C@H]1C(=O)NC(C)(C)C)C=C[C@H]([C@H]2C(=O)N[C]1[CH][CH][CH][CH][C]1C)O3)C |
| Gibbs energy | -1428.217887 |
| Thermal correction to Energy | 0.623513 |
| Thermal correction to Enthalpy | 0.624457 |
| Thermal correction to Gibbs energy | 0.530664 |