| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | c1cc([nH+]cc1O)C[C@@H](C(=O)N[C@@H]([C@@H]2[C@H]([C@H]([C@H](O2)n3ccc(=O)[nH]c3=O)O)O)C(=O)[O-])[NH3+] |
| Molar mass | 452.14175 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 10.20745 |
| Number of basis functions | 524 |
| Zero Point Vibrational Energy | 0.464156 |
| InChI | InChI=1/C18H22N5O9/c19-9(5-7-1-2-8(24)6-20-7)15(28)22-11(17(29)30)14-12(26)13(27)16(32-14)23-4-3-10(25)21-18(23)31/h1-4,6,9,11-14,16,20,24,26-27H,5H2,19H3,(H,22,28)(H,21,25,31)/t9-,11-,12-,13+,14+,16-/m0/s1/f/h21-22H |
| Number of occupied orbitals | 118 |
| Energy at 0K | -1639.801322 |
| Input SMILES | O=c1ccn(c(=O)[nH]1)[C@H]1O[C@@H]([C@H]([C@H]1O)O)[C@@H](C(=O)[O-])NC(=O)[C@H](Cc1ccc(c[nH+]1)O)[NH3+] |
| Number of orbitals | 524 |
| Number of virtual orbitals | 406 |
| Standard InChI | InChI=1S/C18H22N5O9/c19-9(5-7-1-2-8(24)6-20-7)15(28)22-11(17(29)30)14-12(26)13(27)16(32-14)23-4-3-10(25)21-18(23)31/h1-4,6,9,11-14,16,20,24,26-27H,5H2,19H3,(H,22,28)(H,21,25,31)/t9-,11-,12-,13+,14+,16-/m0/s1 |
| Total Energy | -1639.774909 |
| Entropy | 2.823445D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1639.773965 |
| Standard InChI Key | InChIKey=KOBPIYHHQBRURU-QHVJXGMISA-N |
| Final Isomeric SMILES | [NH3][C@@H](C[C]1[CH][CH][C](O)[CH]N1)C(=O)N[C@@H]([C@H]2O[C@@H]([C@H](O)[C@@H]2O)N3C=CC(=O)N[C]3[O])C([O])=O |
| SMILES | O=C1C=CN([C]([O])N1)[C@H]1O[C@@H]([C@H]([C@H]1O)O)[C@@H]([C]([O])=O)[NH][C](=O)[C@H](C[C]1[CH][CH][C]([CH][NH]1)O)[NH3] |
| Gibbs energy | -1639.858146 |
| Thermal correction to Energy | 0.49057 |
| Thermal correction to Enthalpy | 0.491514 |
| Thermal correction to Gibbs energy | 0.407333 |