| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | c1cc(c(cc1[N+](=O)[O-])Cl)O[C@H]2[C@@H]([C@@H]([C@@H]([C@@H](O2)CO)O[C@H]3[C@@H]([C@@H]([C@@H]([C@@H](O3)CO)O)O)O)O)O |
| Molar mass | 497.09362 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 11.2412 |
| Number of basis functions | 547 |
| Zero Point Vibrational Energy | 0.483596 |
| InChI | InChI=1/C18H24ClNO13/c19-7-3-6(20(28)29)1-2-8(7)30-17-15(27)13(25)16(10(5-22)32-17)33-18-14(26)12(24)11(23)9(4-21)31-18/h1-3,9-18,21-27H,4-5H2/t9-,10-,11+,12+,13-,14+,15+,16+,17+,18-/m0/s1 |
| Number of occupied orbitals | 130 |
| Energy at 0K | -2182.049047 |
| Input SMILES | OC[C@@H]1O[C@@H](Oc2ccc(cc2Cl)[N+](=O)[O-])[C@@H]([C@@H]([C@@H]1O[C@@H]1O[C@@H](CO)[C@H]([C@H]([C@H]1O)O)O)O)O |
| Number of orbitals | 547 |
| Number of virtual orbitals | 417 |
| Standard InChI | InChI=1S/C18H24ClNO13/c19-7-3-6(20(28)29)1-2-8(7)30-17-15(27)13(25)16(10(5-22)32-17)33-18-14(26)12(24)11(23)9(4-21)31-18/h1-3,9-18,21-27H,4-5H2/t9-,10-,11+,12+,13-,14+,15+,16+,17+,18-/m0/s1 |
| Total Energy | -2182.0187 |
| Entropy | 3.211471D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -2182.017755 |
| Standard InChI Key | InChIKey=RFGBZYLCQCJGOG-RDZGJIMISA-N |
| Final Isomeric SMILES | [O]N([O])[C]1[CH][CH][C](O[C@@H]2O[C@@H](CO)[C@@H](O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H](O)[C@H]3O)[C@@H](O)[C@H]2O)[C](Cl)[CH]1 |
| SMILES | OC[C@@H]1O[C@@H](O[C]2[CH][CH][C]([CH][C]2Cl)[N]([O])[O])[C@@H]([C@@H]([C@@H]1O[C@@H]1O[C@@H](CO)[C@H]([C@H]([C@H]1O)O)O)O)O |
| Gibbs energy | -2182.113505 |
| Thermal correction to Energy | 0.513943 |
| Thermal correction to Enthalpy | 0.514887 |
| Thermal correction to Gibbs energy | 0.419137 |