| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | c1ccc(c(c1)NC(=O)COC(=O)CN2C(=O)[C@H]3[C@@H]4C[C@H]([C@H]3C2=O)C=C4)N5CCCC5=O |
| Molar mass | 437.15869 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 12.27659 |
| Number of basis functions | 526 |
| Zero Point Vibrational Energy | 0.475299 |
| InChI | InChI=1/C23H23N3O6/c27-17(24-15-4-1-2-5-16(15)25-9-3-6-18(25)28)12-32-19(29)11-26-22(30)20-13-7-8-14(10-13)21(20)23(26)31/h1-2,4-5,7-8,13-14,20-21H,3,6,9-12H2,(H,24,27)/t13-,14+,20-,21+/f/h24H |
| Number of occupied orbitals | 115 |
| Energy at 0K | -1496.487612 |
| Input SMILES | O=C(CN1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C[C@@H]2C=C1)OCC(=O)Nc1ccccc1N1CCCC1=O |
| Number of orbitals | 526 |
| Number of virtual orbitals | 411 |
| Standard InChI | InChI=1S/C23H23N3O6/c27-17(24-15-4-1-2-5-16(15)25-9-3-6-18(25)28)12-32-19(29)11-26-22(30)20-13-7-8-14(10-13)21(20)23(26)31/h1-2,4-5,7-8,13-14,20-21H,3,6,9-12H2,(H,24,27)/t13-,14+,20-,21+ |
| Total Energy | -1496.461992 |
| Entropy | 2.989200D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1496.461048 |
| Standard InChI Key | InChIKey=MWVWTZWVIGGRHA-BAEXCKCRSA-N |
| Final Isomeric SMILES | O=C(COC(=O)CN1C(=O)[C@H]2[C@@H]3C[C@@H](C=C3)[C@H]2C1=O)N[C]4[CH][CH][CH][CH][C]4N5CCCC5=O |
| SMILES | O=C(CN1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C[C@@H]2C=C1)OCC(=O)N[C]1[CH][CH][CH][CH][C]1N1CCCC1=O |
| Gibbs energy | -1496.550171 |
| Thermal correction to Energy | 0.500919 |
| Thermal correction to Enthalpy | 0.501863 |
| Thermal correction to Gibbs energy | 0.41274 |