| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | c1ccc(cc1)/C(=C/2\[C@@H](N(C(=O)C2=O)CC[NH2+]CCO)c3ccc(cc3)F)/O |
| Molar mass | 385.15636 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 10.26296 |
| Number of basis functions | 464 |
| Zero Point Vibrational Energy | 0.439513 |
| InChI | InChI=1/C21H22FN2O4/c22-16-8-6-14(7-9-16)18-17(19(26)15-4-2-1-3-5-15)20(27)21(28)24(18)12-10-23-11-13-25/h1-9,18,25-26H,10-13,23H2/t18-/m0/s1 |
| Number of occupied orbitals | 101 |
| Energy at 0K | -1315.197855 |
| Input SMILES | OCC[NH2+]CCN1[C@@H](c2ccc(cc2)F)/C(=C(\c2ccccc2)/O)/C(=O)C1=O |
| Number of orbitals | 464 |
| Number of virtual orbitals | 363 |
| Standard InChI | InChI=1S/C21H22FN2O4/c22-16-8-6-14(7-9-16)18-17(19(26)15-4-2-1-3-5-15)20(27)21(28)24(18)12-10-23-11-13-25/h1-9,18,25-26H,10-13,23H2/t18-/m0/s1 |
| Total Energy | -1315.174218 |
| Entropy | 2.727587D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1315.173274 |
| Standard InChI Key | InChIKey=CXVRSEGSYMWWAO-SFHVURJKSA-N |
| Final Isomeric SMILES | OCC[NH2]CCN1[C@@H]([C]2[CH][CH][C](F)[CH][CH]2)[C]([C](O)[C]3[CH][CH][CH][CH][CH]3)C(=O)C1=O |
| SMILES | OCC[NH2]CC[N]1[C](=O)[C]([C]([C]([OH])[C]2[CH][CH][CH][CH][CH]2)[C@@H]1[C]1[CH][CH][C]([CH][CH]1)F)=O |
| Gibbs energy | -1315.254597 |
| Thermal correction to Energy | 0.46315 |
| Thermal correction to Enthalpy | 0.464094 |
| Thermal correction to Gibbs energy | 0.38277 |